ALK-IN-1 (Brigatinib analog, AP26113 analog)
Catalog No. A11948
Catalog Num | A11948 |
---|---|
M. Wt | 529.01 |
Formula | C26H34ClN6O2P |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 1197958-12-5 |
Synonyms | AP-26113 |
SMILES | CN(C)C1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4P(=O)(C)C)Cl)OC |
Targets
Target | Value |
---|---|
ALK | IC50: 0.62nM |
FER | IC50: 1.3nM |
ROS/ROS1 | IC50: 1.9nM |
FLT3 | IC50: 2.1nM |
FES/FPS | IC50: 3.4nM |
FAK/PTK2 | IC50: 3.8nM |
BRK | IC50: 4.1nM |
STK22D | IC50: 4.3nM |
Chk2 | IC50: 6.5nM |
RSK2 | IC50: 13nM |
TYK/LTK | IC50: 13nM |
YES | IC50: 19nM |
PYK2 | IC50: 24nM |
ErbB4 | IC50: 27nM |
CLK1 | IC50: 29nM |
CaMKIId | IC50: 29nM |
Chk1 | IC50: 30nM |
RSK1 | IC50: 30nM |
RSK4 | IC50: 42nM |
IRR/INSRR | IC50: 45nM |
IGF-1R | IC50: 46nM |
ARK5 | IC50: 47nM |
CaMKIIg | IC50: 48nM |
LRRK2 | IC50: 51nM |
FRK | IC50: 52nM |
FLT4 | IC50: 58nM |
RET | IC50: 65nM |
CaMKK2 | IC50: 83nM |
MARK2 | IC50: 94nM |
PKCnu | IC50: 95nM |
PHKg2 | IC50: 108nM |
LOK/STK10 | IC50: 123nM |
BRSK2 | IC50: 125nM |
MARK3 | IC50: 127nM |
MARK1 | IC50: 127nM |
FGFR1 | IC50: 128nM |
EGFR | IC50: 129nM |
BLK | IC50: 136nM |
TSSK2 | IC50: 138nM |
AuroraA | IC50: 146nM |
JAK2 | IC50: 154nM |
FGFR4 | IC50: 181nM |
PKCmu/PKD1 | IC50: 197nM |
Fyn | IC50: 198nM |
Hck | IC50: 198nM |
MLK1/MAP3K9 | IC50: 218nM |
FGFR2 | IC50: 228nM |
CLK2 | IC50: 240nM |
Lyn | IC50: 241nM |
PKD2/PRKD2 | IC50: 285nM |
c-Src | IC50: 329nM |
BRSK1 | IC50: 338nM |
FGFR3 | IC50: 358nM |
Fms | IC50: 358nM |
Insulin Receptor | IC50: 395nM |
SIK2/SNF1LK2/QIK | IC50: 466nM |
FGR | IC50: 491nM |
TAOK1 | IC50: 492nM |
Abl1 | IC50: 500nM |
LCK | IC50: 512nM |
PLK1 | IC50: 611nM |
BTK | IC50: 673nM[null] |
In vitro (25°C) | DMSO | 40 mg/mL (75.61 mM) | |
Water | Insoluble | ||
Ethanol | 93 mg/mL (175.8 mM) | ||
In vivo | NMP+PEG300 (10+90, v+v) | 28 mg/mL | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 18.9 mL | 94.52 mL | 189.03 mL |
0.5 mM | 3.78 mL | 18.9 mL | 37.81 mL |
1 mM | 1.89 mL | 9.45 mL | 18.9 mL |
5 mM | 0.38 mL | 1.89 mL | 3.78 mL |
*The above data is based on the productmolecular weight 529.01. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
1. Shiao et al., Anaplastic Lymphoma Kinase (ALK) Inhibitors: New Cancer Breakthroughs for Lung Cancer, J. Cancer. Res. Pract. 2011, 27(4), 143-156.
2. Rivera et al., Efficacy and pharmacodynamic analysis of AP26113, a potent and selective orally active inhibitor of Anaplastic Lymphoma Kinase (ALK). Cancer Res. 2010, 70(8), Suppl 1., AACR 101st Annual Meeting 2010.
3. Katayama et al., Therapeutic strategies to overcome crizotinib resistance in non-small cell lung cancers harboring the fusion oncogene EML4-ALK. Proc. Natl. Acad. Sci. 2011, 108(18), 7535-7540. Pubmed ID: 21502504