NPI64
Catalog No. A17220
NPI64 is a broad-spectrum coronavirus protease inhibitor which inhibits viral 3C and 3C-like protease.
| Catalog Num | A17220 |
|---|---|
| M. Wt | 704.77 |
| Formula | C34H41N4NaO9S |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1482494-72-3 |
| Synonyms | NPI 64, NPI-64 |
| SMILES | O=S(C(O)[C@H](C[C@H]1C(NCC1)=O)NC([C@H](CC(C)C)NC([C@H](CC2=C3C=CC=CC3=CC=C2)NC(OCC4=CC=CC=C4)=O)=O)=O)([O-])=O.[Na+] |
NPI64 is a broad-spectrum coronavirus protease inhibitor which inhibits viral 3C and 3C-like protease.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.19 mL | 70.95 mL | 141.89 mL |
| 0.5 mM | 2.84 mL | 14.19 mL | 28.38 mL |
| 1 mM | 1.42 mL | 7.09 mL | 14.19 mL |
| 5 mM | 0.28 mL | 1.42 mL | 2.84 mL |
*The above data is based on the productmolecular weight 704.77. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.