GnRH Associated Peptide (GAP) (1-13), human
Catalog No. A14876
N/A
Catalog Num | A14876 |
---|---|
M. Wt | 1492.58 |
Formula | C65H101N15O25 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 100111-07-7 |
Synonyms | |
SMILES | CCC(C)C(C(=O)NC(C(C)C)C(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(C(C)CC)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)O)N |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 6.7 mL | 33.5 mL | 67 mL |
0.5 mM | 1.34 mL | 6.7 mL | 13.4 mL |
1 mM | 0.67 mL | 3.35 mL | 6.7 mL |
5 mM | 0.13 mL | 0.67 mL | 1.34 mL |
*The above data is based on the productmolecular weight 1492.58. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.