Genistein
Catalog No. A10425
Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis.
Catalog Num | A10425 |
---|---|
M. Wt | 270.24 |
Formula | C15H10O5 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 446-72-0 |
Synonyms | NPI 031L, NPI-031L, NPI031L |
SMILES | OC1=C2C(OC=C(C3=CC=C(O)C=C3)C2=O)=CC(O)=C1 |
Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis.
In vitro | DMSO | 50 mg/mL (185.02 mM) | |
Water | Insoluble | ||
Ethanol | 2 mg/mL (7.4 mM) | ||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 37 mL | 185.02 mL | 370.04 mL |
0.5 mM | 7.4 mL | 37 mL | 74.01 mL |
1 mM | 3.7 mL | 18.5 mL | 37 mL |
5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
*The above data is based on the productmolecular weight 270.24. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.