lumateperone Tosylate
Catalog No. A12279
Lumateperone Tosylate is a 5-HT2A receptor antagonist (Ki = 0.54 nM), a partial agonist of presynaptic D2 receptors and an antagonist of postsynaptic D2 receptors (Ki = 32 nM), and a SERT blocker (Ki = 61 nM).
| Catalog Num | A12279 |
|---|---|
| M. Wt | 565.7 |
| Formula | C31H36FN3O4S |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1187020-80-9 |
| Synonyms | ITI-007, ITI007, ITI 007 |
| SMILES | O=C(C1=CC=C(F)C=C1)CCCN2CC[C@@](N3CCN(C)C4=C3C5=CC=C4)([H])[C@@]5([H])C2.O=S(C6=CC=C(C)C=C6)(O)=O |
Lumateperone Tosylate is a 5-HT2A receptor antagonist (Ki = 0.54 nM), a partial agonist of presynaptic D2 receptors and an antagonist of postsynaptic D2 receptors (Ki = 32 nM), and a SERT blocker (Ki = 61 nM).
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.68 mL | 88.39 mL | 176.77 mL |
| 0.5 mM | 3.54 mL | 17.68 mL | 35.35 mL |
| 1 mM | 1.77 mL | 8.84 mL | 17.68 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.54 mL |
*The above data is based on the productmolecular weight 565.7. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.