HSL-IN-1
Catalog No. A13174
HSL-IN-1 (compound 24b) is a potent and orally active hormone sensitive lipase (HSL) inhibitor (IC50=2 nM) with a significantly reduced reactive metabolite liability.
| Catalog Num | A13174 |
|---|---|
| M. Wt | 436.58 |
| Formula | C19H13BClF3N2O4 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 2095156-13-9 |
| Synonyms | |
| SMILES | O=C(NC1=C(B(O)O)C=C(Cl)C=C1)C(C=C2)=CN=C2OC3=CC=C(C(F)(F)F)C=C3 |
HSL-IN-1 (compound 24b) is a potent and orally active hormone sensitive lipase (HSL) inhibitor (IC50=2 nM) with a significantly reduced reactive metabolite liability.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.91 mL | 114.53 mL | 229.05 mL |
| 0.5 mM | 4.58 mL | 22.91 mL | 45.81 mL |
| 1 mM | 2.29 mL | 11.45 mL | 22.91 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.58 mL |
*The above data is based on the productmolecular weight 436.58. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.