Bamirastine
Catalog No. A13325
Bamirastine inhibits ligand binding to recombinant human histamine H1 receptors (rhH1R) with an IC50 value of 17.3 nM.
| Catalog Num | A13325 |
|---|---|
| M. Wt | 527.66 |
| Formula | C31H37N5O3 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 215529-47-8 |
| Synonyms | TAK-427, TAK427, TAK 427 |
| SMILES | O=C(O)C(C)(C)C1=CN2N=C(NCCCN3CCC(OC(C4=CC=CC=C4)C5=CC=CC=C5)CC3)C=CC2=N1 |
Bamirastine inhibits ligand binding to recombinant human histamine H1 receptors (rhH1R) with an IC50 value of 17.3 nM.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.95 mL | 94.76 mL | 189.52 mL |
| 0.5 mM | 3.79 mL | 18.95 mL | 37.9 mL |
| 1 mM | 1.9 mL | 9.48 mL | 18.95 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.79 mL |
*The above data is based on the productmolecular weight 527.66. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.