Tasimelteon
Catalog No. A17351
Tasimelteon is a melatonin MT1 and MT2 receptor agonist.
Catalog Num | A17351 |
---|---|
M. Wt | 245.32 |
Formula | C15H19NO2 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 609799-22-6 |
Synonyms | BMS214778, BMS-214778, BMS 214778, VEC162, VEC-162, VEC 162, Tasimelteon, Hetlioz |
SMILES | CCC(NC[C@H]1[C@H](C2=C3CCOC3=CC=C2)C1)=O |
Tasimelteon is a melatonin MT1 and MT2 receptor agonist.
In vitro | DMSO | 44 mg/mL (179.35 mM) | |
Water | |||
Ethanol | |||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 40.76 mL | 203.82 mL | 407.63 mL |
0.5 mM | 8.15 mL | 40.76 mL | 81.53 mL |
1 mM | 4.08 mL | 20.38 mL | 40.76 mL |
5 mM | 0.82 mL | 4.08 mL | 8.15 mL |
*The above data is based on the productmolecular weight 245.32. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.