Trimethobenzamide hydrochloride
Catalog No. A17648
Trimethobenzamide hydrochloride is a blocker of the D2 receptor. Trimethobenzamide is an antiemetic used to prevent nausea and vomiting.
| Catalog Num | A17648 |
|---|---|
| M. Wt | 424.92 |
| Formula | C21H29ClN2O5 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 554-92-7 |
| Synonyms | Ro 2-9578, Ro2-9578, Ro-2-9578 |
| SMILES | O=C(NCC1=CC=C(OCCN(C)C)C=C1)C2=CC(OC)=C(OC)C(OC)=C2.Cl |
Trimethobenzamide hydrochloride is a blocker of the D2 receptor. Trimethobenzamide is an antiemetic used to prevent nausea and vomiting.
| In vitro | DMSO | 81 mg/mL (190.62 mM) | |
| Water | |||
| Ethanol | |||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.53 mL | 117.67 mL | 235.34 mL |
| 0.5 mM | 4.71 mL | 23.53 mL | 47.07 mL |
| 1 mM | 2.35 mL | 11.77 mL | 23.53 mL |
| 5 mM | 0.47 mL | 2.35 mL | 4.71 mL |
*The above data is based on the productmolecular weight 424.92. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.