Fosfomycin calcium
Catalog No. A18154
Fosfomycin calcium is a MurA and isopentenyl mevalonate kinase inhibitor that prevents synthesis of bacterial cell walls.
| Catalog Num | A18154 |
|---|---|
| M. Wt | 314.17 |
| Formula | C6H12CaO8P2 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 26016-98-8 |
| Synonyms | Calcium fosfomycin; AN-8336; CS-4631; AN8336; CS4631; AN 8336; CS 4631 |
| SMILES | C[C@H]1[C@@H](P(O)([O-])=O)O1.CC2C(P(O)([O-])=O)O2.[Ca+2] |
Fosfomycin calcium is a MurA and isopentenyl mevalonate kinase inhibitor that prevents synthesis of bacterial cell walls.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.83 mL | 159.15 mL | 318.3 mL |
| 0.5 mM | 6.37 mL | 31.83 mL | 63.66 mL |
| 1 mM | 3.18 mL | 15.91 mL | 31.83 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.37 mL |
*The above data is based on the productmolecular weight 314.17. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.