KPLH1130
Catalog No. A18494
KPLH1130 is a specific pyruvate dehydrogenase kinase (PDK) inhibitor, blocks macrophage polarization and attenuates proinflammatory responses. KPLH1130 improves glucose tolerance in HFD-fed mice.
| Catalog Num | A18494 |
|---|---|
| M. Wt | 283.28 |
| Formula | C15H13N3O3 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 906669-07-6 |
| Synonyms | KPLH 1130, KPLH-1130 |
| SMILES | OC1=CC=C(C2=NNC(N2C3=CC=C(C)C=C3)=O)C(O)=C1 |
KPLH1130 is a specific pyruvate dehydrogenase kinase (PDK) inhibitor, blocks macrophage polarization and attenuates proinflammatory responses. KPLH1130 improves glucose tolerance in HFD-fed mice.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.3 mL | 176.5 mL | 353.01 mL |
| 0.5 mM | 7.06 mL | 35.3 mL | 70.6 mL |
| 1 mM | 3.53 mL | 17.65 mL | 35.3 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.06 mL |
*The above data is based on the productmolecular weight 283.28. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.