VCE-004.8
Catalog No. A18549
VCE-004.8, a semi-synthetic multitarget cannabinoquinoid, is a specific PPARγ and CB2 receptor dual agonist with potent anti-inflammatory activity.
| Catalog Num | A18549 |
|---|---|
| M. Wt | 433.58 |
| Formula | C28H35NO3 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1818428-24-8 |
| Synonyms | VCE-?004.8, VCE004.8, VCE-?0048 |
| SMILES | O=C1C(O)=C([C@@H]2C=C(C)CC[C@H]2C(C)=C)C(C(NCC3=CC=CC=C3)=C1CCCCC)=O |
VCE-004.8, a semi-synthetic multitarget cannabinoquinoid, is a specific PPARγ and CB2 receptor dual agonist with potent anti-inflammatory activity.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.06 mL | 115.32 mL | 230.64 mL |
| 0.5 mM | 4.61 mL | 23.06 mL | 46.13 mL |
| 1 mM | 2.31 mL | 11.53 mL | 23.06 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.61 mL |
*The above data is based on the productmolecular weight 433.58. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.