Taurodeoxycholate sodium salt
Catalog No. A18577
Taurodeoxycholate sodium salt is a bile salt-related anionic detergent used for isolation of membrane proteins including inner mitochondrial membrane proteins. Taurodeoxycholate (TDCA) inhibits various inflammatory responses.
| Catalog Num | A18577 |
|---|---|
| M. Wt | 521.69 |
| Formula | C26H44NNaO6S |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1180-95-6 |
| Synonyms | |
| SMILES | O=S([O-])(CCNC(CC[C@@H](C)[C@H]1CCC2C3CCC4C[C@H](O)CC[C@]4(C)C3C[C@H](O)[C@]12C)=O)=O.[Na+] |
Taurodeoxycholate sodium salt is a bile salt-related anionic detergent used for isolation of membrane proteins including inner mitochondrial membrane proteins. Taurodeoxycholate (TDCA) inhibits various inflammatory responses.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.17 mL | 95.84 mL | 191.68 mL |
| 0.5 mM | 3.83 mL | 19.17 mL | 38.34 mL |
| 1 mM | 1.92 mL | 9.58 mL | 19.17 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.83 mL |
*The above data is based on the productmolecular weight 521.69. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.