ALLO-1
Catalog No. A18670
ALLO-1, an autophagy receptor, is essential for autophagosome formation around paternal organelles and directly binds to the worm LC3 homologue LGG-1 through its LC3-interacting region (LIR) motif.
| Catalog Num | A18670 |
|---|---|
| M. Wt | 314.77 |
| Formula | C17H15ClN2O2 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 37468-32-9 |
| Synonyms | ALLO1, ALLO 1 |
| SMILES | O=C1N(C(N(C1C)CC2=CC=CC=C2)=O)C3=CC=C(C=C3)Cl |
ALLO-1, an autophagy receptor, is essential for autophagosome formation around paternal organelles and directly binds to the worm LC3 homologue LGG-1 through its LC3-interacting region (LIR) motif.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.77 mL | 158.85 mL | 317.69 mL |
| 0.5 mM | 6.35 mL | 31.77 mL | 63.54 mL |
| 1 mM | 3.18 mL | 15.88 mL | 31.77 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.35 mL |
*The above data is based on the productmolecular weight 314.77. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.