Dicarbine
Catalog No. A18925
Dicarbine blocks dopamine receptors in various brain parts and prevents the depression of the conditioned defence reflexes caused by stimulation of the mesencephalic portion of the reticular formation. Dicarbine could be used to treat patients with schizophrenia and alcoholic psychosis in clinical.
| Catalog Num | A18925 |
|---|---|
| M. Wt | 202.3 |
| Formula | C13H18N2 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 17411-19-7 |
| Synonyms | 0 |
| SMILES | CN1CC2C(C=C(C)C=C3)=C3NC2CC1 |
Dicarbine blocks dopamine receptors in various brain parts and prevents the depression of the conditioned defence reflexes caused by stimulation of the mesencephalic portion of the reticular formation. Dicarbine could be used to treat patients with schizophrenia and alcoholic psychosis in clinical.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.43 mL | 247.16 mL | 494.32 mL |
| 0.5 mM | 9.89 mL | 49.43 mL | 98.86 mL |
| 1 mM | 4.94 mL | 24.72 mL | 49.43 mL |
| 5 mM | 0.99 mL | 4.94 mL | 9.89 mL |
*The above data is based on the productmolecular weight 202.3. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.