UBCS039
Catalog No. A18961
UBCS039 is the first synthetic, specific Sirtuin 6 (SIRT6) activator, inducing autophagy in human tumor cells, with an EC50 of 38 μM.
Catalog Num | A18961 |
---|---|
M. Wt | 247.29 |
Formula | C16H13N3 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 358721-70-7 |
Synonyms | UBCS 039, UBCS-039 |
SMILES | N12C(C(C3=CC=CN=C3)NC4=C2C=CC=C4)=CC=C1 |
UBCS039 is the first synthetic, specific Sirtuin 6 (SIRT6) activator, inducing autophagy in human tumor cells, with an EC50 of 38 μM.
In vitro | DMSO | 42 mg/mL (169.83 mM) | |
Water | Insoluble | ||
Ethanol | 14 mg/mL (56.61 mM) | ||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 40.44 mL | 202.19 mL | 404.38 mL |
0.5 mM | 8.09 mL | 40.44 mL | 80.88 mL |
1 mM | 4.04 mL | 20.22 mL | 40.44 mL |
5 mM | 0.81 mL | 4.04 mL | 8.09 mL |
*The above data is based on the productmolecular weight 247.29. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.