SBI-477
Catalog No. A18962
SBI-477 is a chemical probe stimulated insulin signaling by deactivating the transcription factor MondoA, leading to reduced expression of the insulin pathway suppressors thioredoxin-interacting protein (TXNIP) and arrestin domain?Ccontaining 4 (ARRDC4).
| Catalog Num | A18962 |
|---|---|
| M. Wt | 483.54 |
| Formula | C24H25N3O6S |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 781628-99-7 |
| Synonyms | SBI477, SBI 477 |
| SMILES | O=C(NC1=NC(C2=CC=C(OC)C=C2)=CS1)C3=CC=C(OCC(N4CCOCC4)=O)C(OC)=C3 |
SBI-477 is a chemical probe stimulated insulin signaling by deactivating the transcription factor MondoA, leading to reduced expression of the insulin pathway suppressors thioredoxin-interacting protein (TXNIP) and arrestin domain?Ccontaining 4 (ARRDC4).
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.68 mL | 103.4 mL | 206.81 mL |
| 0.5 mM | 4.14 mL | 20.68 mL | 41.36 mL |
| 1 mM | 2.07 mL | 10.34 mL | 20.68 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.14 mL |
*The above data is based on the productmolecular weight 483.54. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.