Demethoxydeacetoxypseudolaric acid B analog
Catalog No. A18986
Demethoxydeacetoxypseudolaric acid B analog (Compound 13b) is semi-synthesized by efficient routines from Pseudolaric acid B. It has potent activities against HMEC-1, HL-60, A-549, MB-MDA-468, BEL-7402, HCT116, and Hela cells with IC50s ranging from 0.136 to 1.162 μM.
| Catalog Num | A18986 |
|---|---|
| M. Wt | 446.49 |
| Formula | C24H30O8 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 500736-17-4 |
| Synonyms | |
| SMILES | CC(O[C@]12[C@@]3(CC=C(C(OCC)=O)CC2)C(O[C@@](/C=C/C=C(C)/C(O)=O)(C)[C@]1([H])CC3)=O)=O |
Demethoxydeacetoxypseudolaric acid B analog (Compound 13b) is semi-synthesized by efficient routines from Pseudolaric acid B. It has potent activities against HMEC-1, HL-60, A-549, MB-MDA-468, BEL-7402, HCT116, and Hela cells with IC50s ranging from 0.136 to 1.162 μM.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.4 mL | 111.98 mL | 223.97 mL |
| 0.5 mM | 4.48 mL | 22.4 mL | 44.79 mL |
| 1 mM | 2.24 mL | 11.2 mL | 22.4 mL |
| 5 mM | 0.45 mL | 2.24 mL | 4.48 mL |
*The above data is based on the productmolecular weight 446.49. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.