Zapalog
Catalog No. A18992
Zapalog is a photocleavable small-molecule heterodimerizer that can be used to repeatedly initiate, and instantaneously terminate, a physical interaction between two target proteins. Zapalog dimerizes any two proteins tagged with the FKBP and DHFR domains until exposure to light causes its photolysis.
| Catalog Num | A18992 |
|---|---|
| M. Wt | 1108.24 |
| Formula | C58H73N7O15 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1708091-24-0 |
| Synonyms | |
| SMILES | O=C([C@H]1N(C(C(C(C)(C)CC)=O)=O)CCCC1)O[C@@H](C2=CC=CC(NC(CCCOC3=CC([N+]([O-])=O)=C(C(OCCOC4=C(OC)C=C(CC5=CN=C(N)N=C5N)C=C4OC)C)C=C3OC)=O)=C2)CCC6=CC=C(OC)C(OC)=C6 |
Zapalog is a photocleavable small-molecule heterodimerizer that can be used to repeatedly initiate, and instantaneously terminate, a physical interaction between two target proteins. Zapalog dimerizes any two proteins tagged with the FKBP and DHFR domains until exposure to light causes its photolysis.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 9.02 mL | 45.12 mL | 90.23 mL |
| 0.5 mM | 1.8 mL | 9.02 mL | 18.05 mL |
| 1 mM | 0.9 mL | 4.51 mL | 9.02 mL |
| 5 mM | 0.18 mL | 0.9 mL | 1.8 mL |
*The above data is based on the productmolecular weight 1108.24. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.