Asoprisnil
Catalog No. A19030
Asoprisnil (J867), a selective progesterone receptor modulator, exhibits mixed progesterone agonist and antagonist effects on various progesterone targeted tissues in animal and human.
| Catalog Num | A19030 |
|---|---|
| M. Wt | 449.58 |
| Formula | C28H35NO4 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 199396-76-4 |
| Synonyms | J867, J-867, J 867 |
| SMILES | C[C@@]12[C@@](OC)(CC[C@]1([C@@]3(CCC4=CC(CCC4=C3[C@H](C2)C5=CC=C(C=C5)/C=N/O)=O)[H])[H])COC |
Asoprisnil (J867), a selective progesterone receptor modulator, exhibits mixed progesterone agonist and antagonist effects on various progesterone targeted tissues in animal and human.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.24 mL | 111.21 mL | 222.43 mL |
| 0.5 mM | 4.45 mL | 22.24 mL | 44.49 mL |
| 1 mM | 2.22 mL | 11.12 mL | 22.24 mL |
| 5 mM | 0.44 mL | 2.22 mL | 4.45 mL |
*The above data is based on the productmolecular weight 449.58. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.