FKBP12 PROTAC dTAG-7
Catalog No. A19081
FKBP12 PROTAC dTAG-7 (dTAG-7) is a heterobifunctional degrader.
Catalog Num | A19081 |
---|---|
M. Wt | 1210.32 |
Formula | C63H79N5O19 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 2064175-32-0 |
Synonyms | dTAG-7 |
SMILES | O=C([C@H]1N(C([C@H](C2=CC(OC)=C(OC)C(OC)=C2)CC)=O)CCCC1)O[C@@H](C3=CC=CC=C3OCC(NCCCOCCOCCOCCCNC(COC4=CC=CC(C(N5C(CC6)C(NC6=O)=O)=O)=C4C5=O)=O)=O)CCC7=CC=C(OC)C(OC)=C7 |
FKBP12 PROTAC dTAG-7 (dTAG-7) is a heterobifunctional degrader.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 8.26 mL | 41.31 mL | 82.62 mL |
0.5 mM | 1.65 mL | 8.26 mL | 16.52 mL |
1 mM | 0.83 mL | 4.13 mL | 8.26 mL |
5 mM | 0.17 mL | 0.83 mL | 1.65 mL |
*The above data is based on the productmolecular weight 1210.32. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.