THAL-SNS-032
Catalog No. A19088
THAL-SNS-032 is a selective CDK9 degrader PROTAC consisting of a CDK-binding SNS-032 ligand linked to a thalidomide derivative that binds the E3 ubiquitin ligase Cereblon (CRBN).
Catalog Num | A19088 |
---|---|
M. Wt | 869.02 |
Formula | C40H52N8O10S2 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 2139287-33-3 |
Synonyms | |
SMILES | O=C(NCCOCCOCCOCCNC1=CC=CC(C(N2C(CC3)C(NC3=O)=O)=O)=C1C2=O)CN4CCC(C(NC5=NC=C(SCC6=NC=C(C(C)(C)C)O6)S5)=O)CC4 |
THAL-SNS-032 is a selective CDK9 degrader PROTAC consisting of a CDK-binding SNS-032 ligand linked to a thalidomide derivative that binds the E3 ubiquitin ligase Cereblon (CRBN).
In vitro | DMSO | 89 mg/mL (102.41 mM) | |
Water | Insoluble | ||
Ethanol | 27 mg/mL | ||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 11.51 mL | 57.54 mL | 115.07 mL |
0.5 mM | 2.3 mL | 11.51 mL | 23.01 mL |
1 mM | 1.15 mL | 5.75 mL | 11.51 mL |
5 mM | 0.23 mL | 1.15 mL | 2.3 mL |
*The above data is based on the productmolecular weight 869.02. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.