Kynurenic acid sodium
Catalog No. A20000
Kynurenic acid sodium, an endogenous tryptophan metabolite, is a broad-spectrum antagonist targeting NMDA, glutamate, α7 nicotinic acetylcholine receptor. Kynurenic acid sodium is also an agonist of GPR35/CXCR8.
| Catalog Num | A20000 |
|---|---|
| M. Wt | 212.16 |
| Formula | C10H7NNaO3 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | CAS: 2439-02-3 |
| Synonyms | |
| SMILES | O=C(C1=NC2=CC=CC=C2C(O)=C1)O.[NaH] |
Kynurenic acid sodium, an endogenous tryptophan metabolite, is a broad-spectrum antagonist targeting NMDA, glutamate, α7 nicotinic acetylcholine receptor. Kynurenic acid sodium is also an agonist of GPR35/CXCR8.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 47.13 mL | 235.67 mL | 471.34 mL |
| 0.5 mM | 9.43 mL | 47.13 mL | 94.27 mL |
| 1 mM | 4.71 mL | 23.57 mL | 47.13 mL |
| 5 mM | 0.94 mL | 4.71 mL | 9.43 mL |
*The above data is based on the productmolecular weight 212.16. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.