Imazamox
Catalog No. A20503
Imazamox (CL29926) is a systemic herbicide that inhibits the production of acetolactate synthase (ALS) in plants with high selectivity, high activity, safety and broadspectrum activity, which would then inhibit plant growth and ultimately lead to plant death.
| Catalog Num | A20503 |
|---|---|
| M. Wt | 305.33 |
| Formula | C15H19N3O4 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 114311-32-9 |
| Synonyms | CL29926, CL 29926, CL-29926; (±)-Imazamox |
| SMILES | O=C(C1=CC(COC)=CN=C1C(NC2(C)C(C)C)=NC2=O)O |
Imazamox (CL29926) is a systemic herbicide that inhibits the production of acetolactate synthase (ALS) in plants with high selectivity, high activity, safety and broadspectrum activity, which would then inhibit plant growth and ultimately lead to plant death.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.76 mL | 327.51 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.5 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.75 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
*The above data is based on the productmolecular weight 305.33. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.