Cyclo(his-pro)
Catalog No. A20552
Cyclo(his-pro) (Cyclo(histidyl-proline)) is an orally active cyclic dipeptide structurally related to tyreotropin-releasing hormone. Cyclo(his-pro) could inhibit NF-κB nuclear accumulation.
| Catalog Num | A20552 |
|---|---|
| M. Wt | 234.25 |
| Formula | C11H14N4O2 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 53109-32-3 |
| Synonyms | Cyclo(histidyl-proline); Histidylproline diketopiperazine |
| SMILES | O=C(N[C@H]1CC2=CN=CN2)[C@@](CCC3)([H])N3C1=O |
Cyclo(his-pro) (Cyclo(histidyl-proline)) is an orally active cyclic dipeptide structurally related to tyreotropin-releasing hormone. Cyclo(his-pro) could inhibit NF-κB nuclear accumulation.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.69 mL | 213.45 mL | 426.89 mL |
| 0.5 mM | 8.54 mL | 42.69 mL | 85.38 mL |
| 1 mM | 4.27 mL | 21.34 mL | 42.69 mL |
| 5 mM | 0.85 mL | 4.27 mL | 8.54 mL |
*The above data is based on the productmolecular weight 234.25. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.