FITC
Catalog No. A20675
FITC is a derivative of fluorescein for the labeling of amines.
Catalog Num | A20675 |
---|---|
M. Wt | 389.38 |
Formula | C21H11NO5S |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 3326-32-7 |
Synonyms | Fluorescein 5-isothiocyanate |
SMILES | O=C1OC2(C3=C(OC4=C2C=CC(O)=C4)C=C(O)C=C3)C5=C1C=C(N=C=S)C=C5 |
FITC is a derivative of fluorescein for the labeling of amines.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 25.68 mL | 128.41 mL | 256.82 mL |
0.5 mM | 5.14 mL | 25.68 mL | 51.36 mL |
1 mM | 2.57 mL | 12.84 mL | 25.68 mL |
5 mM | 0.51 mL | 2.57 mL | 5.14 mL |
*The above data is based on the productmolecular weight 389.38. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.