APNEA
Catalog No. A20845
APNEA (N6-[2-(4-Aminophenyl)ethyl]adenosine) is a potent, non-selective A3 adenosine receptor agonist.
Catalog Num | A20845 |
---|---|
M. Wt | 386.41 |
Formula | C18H22N6O4 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 89705-21-5 |
Synonyms | N6-[2-(4-Aminophenyl)ethyl]adenosine |
SMILES | OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3NCCC4=CC=C(N)C=C4)O1)O)O |
APNEA (N6-[2-(4-Aminophenyl)ethyl]adenosine) is a potent, non-selective A3 adenosine receptor agonist.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 25.88 mL | 129.4 mL | 258.79 mL |
0.5 mM | 5.18 mL | 25.88 mL | 51.76 mL |
1 mM | 2.59 mL | 12.94 mL | 25.88 mL |
5 mM | 0.52 mL | 2.59 mL | 5.18 mL |
*The above data is based on the productmolecular weight 386.41. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.