K-Ras G12C-IN-2
Catalog No. A20936
K-Ras G12C-IN-2 is an irreversible covalent K-Ras G12C inhibitor.
Catalog Num | A20936 |
---|---|
M. Wt | 418.92 |
Formula | C21H27ClN4O3 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 1629267-75-9 |
Synonyms | |
SMILES | ClC1=C(C2CC2)C=C(NCC(N3CCN(C4CN(C(C=C)=O)C4)CC3)=O)C(O)=C1 |
K-Ras G12C-IN-2 is an irreversible covalent K-Ras G12C inhibitor.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 23.87 mL | 119.35 mL | 238.71 mL |
0.5 mM | 4.77 mL | 23.87 mL | 47.74 mL |
1 mM | 2.39 mL | 11.94 mL | 23.87 mL |
5 mM | 0.48 mL | 2.39 mL | 4.77 mL |
*The above data is based on the productmolecular weight 418.92. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.