Longdaysin
Catalog No. A21022
Longdaysin is a inhibitor of the Wnt/β-catenin signaling pathway, which exerts antitumor effect through blocking CK1δ/ε-dependent Wnt signaling.
Catalog Num | A21022 |
---|---|
M. Wt | 335.33 |
Formula | C16H16F3N5 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 1353867-91-0 |
Synonyms | |
SMILES | FC(F)(F)C1=CC=CC(CNC2=NC=NC3=C2N=CN3C(C)C)=C1 |
Longdaysin is a inhibitor of the Wnt/β-catenin signaling pathway, which exerts antitumor effect through blocking CK1δ/ε-dependent Wnt signaling.
In vitro | DMSO | 66 mg/mL (196.82 mM) | |
Water | Insoluble | ||
Ethanol | 66 mg/mL (196.82 mM) | ||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 29.82 mL | 149.11 mL | 298.21 mL |
0.5 mM | 5.96 mL | 29.82 mL | 59.64 mL |
1 mM | 2.98 mL | 14.91 mL | 29.82 mL |
5 mM | 0.6 mL | 2.98 mL | 5.96 mL |
*The above data is based on the productmolecular weight 335.33. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.