Ombrabulin hydrochloride
Catalog No. A21040
Ombrabulin hydrochloride is a derivative of CA-4 phosphate, which is known to exhibit antivascular effects through selective disruption of the tubulin cytoskeleton of endothelial cells.
| Catalog Num | A21040 |
|---|---|
| M. Wt | 438.9 |
| Formula | C21H27ClN2O6 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 253426-24-3 |
| Synonyms | AVE8062 (hydrochloride), AVE 8062, AVE-8062; AC7700 (hydrochloride), AC 7700, AC-7700 |
| SMILES | O=C(NC1=CC(/C=C\C2=CC(OC)=C(OC)C(OC)=C2)=CC=C1OC)[C@@H](N)CO.[H]Cl |
Ombrabulin hydrochloride is a derivative of CA-4 phosphate, which is known to exhibit antivascular effects through selective disruption of the tubulin cytoskeleton of endothelial cells.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.78 mL | 113.92 mL | 227.84 mL |
| 0.5 mM | 4.56 mL | 22.78 mL | 45.57 mL |
| 1 mM | 2.28 mL | 11.39 mL | 22.78 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.56 mL |
*The above data is based on the productmolecular weight 438.9. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.