AP20187
Catalog No. A21127
AP20187 (B/B Homodimerizer) is a cell-permeable ligand used to dimerize FK506-binding protein (FKBP) fusion proteins and initiate biological signaling cascades and gene expression or disrupt protein-protein interactions.
| Catalog Num | A21127 |
|---|---|
| M. Wt | 1482.75 |
| Formula | C82H107N5O20 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 195514-80-8 |
| Synonyms | B/B Homodimerizer, AP 20187, AP-20187 |
| SMILES | COC1=C(OC)C=C(CC[C@H](C2=CC=CC(OCC(NCC(CN(C)C)CNC(COC3=CC=CC([C@H](OC([C@H]4N(C([C@@H](CC)C5=CC(OC)=C(OC)C(OC)=C5)=O)CCCC4)=O)CCC6=CC(OC)=C(OC)C=C6)=C3)=O)=O)=C2)OC([C@@H]7CCCCN7C([C@H](C8=CC(OC)=C(OC)C(OC)=C8)CC)=O)=O)C=C1 |
AP20187 (B/B Homodimerizer) is a cell-permeable ligand used to dimerize FK506-binding protein (FKBP) fusion proteins and initiate biological signaling cascades and gene expression or disrupt protein-protein interactions.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 6.74 mL | 33.72 mL | 67.44 mL |
| 0.5 mM | 1.35 mL | 6.74 mL | 13.49 mL |
| 1 mM | 0.67 mL | 3.37 mL | 6.74 mL |
| 5 mM | 0.13 mL | 0.67 mL | 1.35 mL |
*The above data is based on the productmolecular weight 1482.75. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.