Prinaberel
Catalog No. A21255
Prinaberel(ERB-041) is a potent and selective ERbeta agonist; being >200-fold selective for ERbeta.
Catalog Num | A21255 |
---|---|
M. Wt | 271.24 |
Formula | C15H10FNO3 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 524684-52-4 |
Synonyms | ERB-041 |
SMILES | OC1=CC(C=C)=C(OC(C2=CC=C(O)C(F)=C2)=N3)C3=C1 |
Prinaberel(ERB-041) is a potent and selective ERbeta agonist; being >200-fold selective for ERbeta.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 36.87 mL | 184.34 mL | 368.68 mL |
0.5 mM | 7.37 mL | 36.87 mL | 73.74 mL |
1 mM | 3.69 mL | 18.43 mL | 36.87 mL |
5 mM | 0.74 mL | 3.69 mL | 7.37 mL |
*The above data is based on the productmolecular weight 271.24. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.