Darusentan
Catalog No. A21280
Darusentan is a selective endothelin A (ETA) receptor antagonist.
Catalog Num | A21280 |
---|---|
M. Wt | 410.42 |
Formula | C22H22N2O6 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 171714-84-4 |
Synonyms | Lu-135252 |
SMILES | COC1=NC(O[C@H](C(O)=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)=NC(OC)=C1 |
Darusentan is a selective endothelin A (ETA) receptor antagonist.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 24.37 mL | 121.83 mL | 243.65 mL |
0.5 mM | 4.87 mL | 24.37 mL | 48.73 mL |
1 mM | 2.44 mL | 12.18 mL | 24.37 mL |
5 mM | 0.49 mL | 2.44 mL | 4.87 mL |
*The above data is based on the productmolecular weight 410.42. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.