INCB053914 phosphate
Catalog No. A21444
INCB053914 phosphate is an inhibitor of Pim extracted from patent WO 2017044730 A1, compound 1; has an IC50 of less than 35 nM.
Catalog Num | A21444 |
---|---|
M. Wt | 611.51 |
Formula | C26H29F3N5O7P |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 2088852-47-3 |
Synonyms | INCB 053914, INCB-053914 |
SMILES | O=C(C1=NC(C2=C(F)C=CC=C2F)=C(F)C=C1)NC3=CN=C4C(CC[C@H]4O)=C3N5C[C@@H](N)[C@H](O)[C@@H](C)C5.OP(O)(O)=O |
INCB053914 phosphate is an inhibitor of Pim extracted from patent WO 2017044730 A1, compound 1; has an IC50 of less than 35 nM.
In vitro | DMSO | 48 mg/mL (78.49 mM) | |
Water | |||
Ethanol | |||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 16.35 mL | 81.76 mL | 163.53 mL |
0.5 mM | 3.27 mL | 16.35 mL | 32.71 mL |
1 mM | 1.64 mL | 8.18 mL | 16.35 mL |
5 mM | 0.33 mL | 1.64 mL | 3.27 mL |
*The above data is based on the productmolecular weight 611.51. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.