Azilsartan D5
Catalog No. A21600
Azilsartan D5 is the deuterium labeled Azilsartan(TAK-536), which is a specific and potent angiotensin II type 1 receptor antagonist.
| Catalog Num | A21600 |
|---|---|
| M. Wt | 461.48 |
| Formula | C25H15D5N4O5 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1346599-45-8 |
| Synonyms | TAK-536 D5 |
| SMILES | OC(C1=CC=CC2=C1N(C(OC(C([2H])([2H])[2H])([2H])[2H])=N2)CC(C=C3)=CC=C3C4=CC=CC=C4C5=NC(ON5)=O)=O |
Azilsartan D5 is the deuterium labeled Azilsartan(TAK-536), which is a specific and potent angiotensin II type 1 receptor antagonist.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.67 mL | 108.35 mL | 216.69 mL |
| 0.5 mM | 4.33 mL | 21.67 mL | 43.34 mL |
| 1 mM | 2.17 mL | 10.83 mL | 21.67 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.33 mL |
*The above data is based on the productmolecular weight 461.48. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.