SCH 50911
Catalog No. A21630
SCH 50911, (+)-(S)-5,5-dimethylmorpholinyl-2-acetic acid, a selective, orally-active and competitive γ-Aminobutyric acid B GABA(B) receptor antagonist.
Catalog Num | A21630 |
---|---|
M. Wt | 173.21 |
Formula | C8H15NO3 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 733717-87-8 |
Synonyms | SCH50911, SCH-50911 |
SMILES | O=C(O)C[C@H]1CNC(C)(C)CO1 |
SCH 50911, (+)-(S)-5,5-dimethylmorpholinyl-2-acetic acid, a selective, orally-active and competitive γ-Aminobutyric acid B GABA(B) receptor antagonist.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 57.73 mL | 288.67 mL | 577.33 mL |
0.5 mM | 11.55 mL | 57.73 mL | 115.47 mL |
1 mM | 5.77 mL | 28.87 mL | 57.73 mL |
5 mM | 1.15 mL | 5.77 mL | 11.55 mL |
*The above data is based on the productmolecular weight 173.21. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.