Rhosin hydrochloride
Catalog No. A21648
Rhosin hydrochloride is a potent, specific RhoA subfamily Rho GTPases inhibitor.
Catalog Num | A21648 |
---|---|
M. Wt | 394.86 |
Formula | C20H19ClN6O |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 1281870-42-5 |
Synonyms | |
SMILES | O=C(N/N=C/C1=CC=C2N=CC=NC2=C1)[C@H](N)CC3=CNC4=C3C=CC=C4.[H]Cl |
Rhosin hydrochloride is a potent, specific RhoA subfamily Rho GTPases inhibitor.
In vitro | DMSO | 85 mg/mL (215.27mM) | |
Water | 34 mg/mL (86.11 mM) | ||
Ethanol | Insoluble | ||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 25.33 mL | 126.63 mL | 253.25 mL |
0.5 mM | 5.07 mL | 25.33 mL | 50.65 mL |
1 mM | 2.53 mL | 12.66 mL | 25.33 mL |
5 mM | 0.51 mL | 2.53 mL | 5.07 mL |
*The above data is based on the productmolecular weight 394.86. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.