CPI-0610 carboxylic acid
Catalog No. A21714
CPI-0610 carboxylic acid is a potent bromodomain and extra-terminal (BET) protein inhibitor. CPI-0610 carboxylic acid has the potential in the therapy of multiple myeloma.
| Catalog Num | A21714 |
|---|---|
| M. Wt | 366.8 |
| Formula | C20H15ClN2O3 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1380089-81-5 |
| Synonyms | CPI0610, CPI 0610 |
| SMILES | O=C(O)C[C@@H]1N=C(C2=CC=C(Cl)C=C2)C3=CC=CC=C3C4=C1ON=C4C |
CPI-0610 carboxylic acid is a potent bromodomain and extra-terminal (BET) protein inhibitor. CPI-0610 carboxylic acid has the potential in the therapy of multiple myeloma.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.26 mL | 136.31 mL | 272.63 mL |
| 0.5 mM | 5.45 mL | 27.26 mL | 54.53 mL |
| 1 mM | 2.73 mL | 13.63 mL | 27.26 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.45 mL |
*The above data is based on the productmolecular weight 366.8. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.