SB 242084
Catalog No. A21715
SB 242084 is a 5-HT2C receptor antagonist(pKi=9.0) that displays 158- and 100-fold selectivity over 5-HT2A and 5-HT2B receptors respectively.
| Catalog Num | A21715 |
|---|---|
| M. Wt | 394.85 |
| Formula | C21H19ClN4O2 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 181632-25-7 |
| Synonyms | SB-242084, SB242084 |
| SMILES | O=C(N1CCC2=C1C=C(Cl)C(C)=C2)NC3=CC=C(OC4=CC=CN=C4C)N=C3 |
SB 242084 is a 5-HT2C receptor antagonist(pKi=9.0) that displays 158- and 100-fold selectivity over 5-HT2A and 5-HT2B receptors respectively.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.33 mL | 126.63 mL | 253.26 mL |
| 0.5 mM | 5.07 mL | 25.33 mL | 50.65 mL |
| 1 mM | 2.53 mL | 12.66 mL | 25.33 mL |
| 5 mM | 0.51 mL | 2.53 mL | 5.07 mL |
*The above data is based on the productmolecular weight 394.85. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.