Fexaramine
Catalog No. A21771
Fexaramine is a small molecule farnesoid X receptor (FXR) agonist with 100-fold increased affinity relative to natural compounds.
Catalog Num | A21771 |
---|---|
M. Wt | 496.64 |
Formula | C32H36N2O3 |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 574013-66-4 |
Synonyms | |
SMILES | CN(C)C1=CC=C(C2=CC=C(CN(C3=CC(/C=C/C(OC)=O)=CC=C3)C(C4CCCCC4)=O)C=C2)C=C1 |
Fexaramine is a small molecule farnesoid X receptor (FXR) agonist with 100-fold increased affinity relative to natural compounds.
In vitro | DMSO | 89 mg/mL (179.2 mM) | |
Water | |||
Ethanol | |||
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 20.14 mL | 100.68 mL | 201.35 mL |
0.5 mM | 4.03 mL | 20.14 mL | 40.27 mL |
1 mM | 2.01 mL | 10.07 mL | 20.14 mL |
5 mM | 0.4 mL | 2.01 mL | 4.03 mL |
*The above data is based on the productmolecular weight 496.64. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.