PSI-6206 13CD3
Catalog No. A21782
PSI-6206 13CD3 is the deuterium labeled PSI-6206. PSI-6206 is the deaminated derivative of PSI-6130, which is a potent and selective inhibitor of HCV NS5B polymerase.
| Catalog Num | A21782 |
|---|---|
| M. Wt | 264.23 |
| Formula | C9 13CH10D3FN2O5 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1256490-42-2 |
| Synonyms | RO-2433 13CD3; GS-331007 13CD3; Sofosbuvir metabolite GS-331007 13CD3 |
| SMILES | OC[C@@H]1[C@H]([C@@]([13C]([2H])([2H])[2H])(F)[C@H](N2C(NC(C=C2)=O)=O)O1)O |
PSI-6206 13CD3 is the deuterium labeled PSI-6206. PSI-6206 is the deaminated derivative of PSI-6130, which is a potent and selective inhibitor of HCV NS5B polymerase.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.85 mL | 189.23 mL | 378.46 mL |
| 0.5 mM | 7.57 mL | 37.85 mL | 75.69 mL |
| 1 mM | 3.78 mL | 18.92 mL | 37.85 mL |
| 5 mM | 0.76 mL | 3.78 mL | 7.57 mL |
*The above data is based on the productmolecular weight 264.23. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.