Nedocromil sodium
Catalog No. A21937
Nedocromil sodium suppresses the action or formation of multiple mediators, including histamine, leukotriene C4 (LTC4), and prostaglandin D2 (PGD2).
| Catalog Num | A21937 |
|---|---|
| M. Wt | 415.3 |
| Formula | C19H15NNa2O7 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 69049-74-7 |
| Synonyms | FPL 59002KP, FPL59002KP, FPL-59002KP; Nedocromil disodium salt |
| SMILES | O=C(C1=CC(C2=CC3=C(N(CC)C(C([O-])=O)=CC3=O)C(CCC)=C2O1)=O)[O-].[Na+].[Na+] |
Nedocromil sodium suppresses the action or formation of multiple mediators, including histamine, leukotriene C4 (LTC4), and prostaglandin D2 (PGD2).
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.08 mL | 120.39 mL | 240.79 mL |
| 0.5 mM | 4.82 mL | 24.08 mL | 48.16 mL |
| 1 mM | 2.41 mL | 12.04 mL | 24.08 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.82 mL |
*The above data is based on the productmolecular weight 415.3. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.