Defactinib
Catalog No. A21958
Defactinib (VS-6063; PF-04554878) is a novel FAK inhibitor with potential antiangiogenic and antineoplastic activities.
Catalog Num | A21958 |
---|---|
M. Wt | 510.49 |
Formula | C20H21F3N8O3S |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 1073154-85-4 |
Synonyms | VS-6063, VS 6063, VS6063; PF-04554878, PF04554878, PF04554878 |
SMILES | O=C(NC)C1=CC=C(NC2=NC=C(C(F)(F)F)C(NCC3=NC=CN=C3N(C)S(=O)(C)=O)=N2)C=C1 |
Defactinib (VS-6063; PF-04554878) is a novel FAK inhibitor with potential antiangiogenic and antineoplastic activities.
In vitro (25°C) | DMSO | Warmed: 5 mg/mL (9.79 mM) | |
Water | Insoluble | ||
Ethanol | Insoluble | ||
In vivo | 5% DMSO+50% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 19.59 mL | 97.95 mL | 195.89 mL |
0.5 mM | 3.92 mL | 19.59 mL | 39.18 mL |
1 mM | 1.96 mL | 9.79 mL | 19.59 mL |
5 mM | 0.39 mL | 1.96 mL | 3.92 mL |
*The above data is based on the productmolecular weight 510.49. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.