CHPG sodium salt
Catalog No. A21968
CHPG sodium salt is a selective mGluR5 agonist, and attenuates SO2-induced oxidative stress and inflammation through TSG-6/NF-κB pathway in BV2 microglial cells.
| Catalog Num | A21968 |
|---|---|
| M. Wt | 223.59 |
| Formula | C8H7ClNNaO3 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1303993-73-8 |
| Synonyms | |
| SMILES | O=C(O[Na])C(N)C1=CC(O)=CC=C1Cl |
CHPG sodium salt is a selective mGluR5 agonist, and attenuates SO2-induced oxidative stress and inflammation through TSG-6/NF-κB pathway in BV2 microglial cells.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.72 mL | 223.62 mL | 447.25 mL |
| 0.5 mM | 8.94 mL | 44.72 mL | 89.45 mL |
| 1 mM | 4.47 mL | 22.36 mL | 44.72 mL |
| 5 mM | 0.89 mL | 4.47 mL | 8.94 mL |
*The above data is based on the productmolecular weight 223.59. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.