Oxotremorine M iodide
Catalog No. A21977
Oxotremorine M iodide is a potent and non-selective muscarinic acetylcholine receptor (mAChR) agonist.
Catalog Num | A21977 |
---|---|
M. Wt | 322.19 |
Formula | C11H19IN2O |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 3854-04-4 |
Synonyms | |
SMILES | O=C1N(CC#CC[N+](C)(C)C)CCC1.[I-] |
Oxotremorine M iodide is a potent and non-selective muscarinic acetylcholine receptor (mAChR) agonist.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 31.04 mL | 155.19 mL | 310.38 mL |
0.5 mM | 6.21 mL | 31.04 mL | 62.08 mL |
1 mM | 3.1 mL | 15.52 mL | 31.04 mL |
5 mM | 0.62 mL | 3.1 mL | 6.21 mL |
*The above data is based on the productmolecular weight 322.19. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.