CRANAD-28
Catalog No. A22102
CRANAD-28, a blood brain barrier (BBB) penetrable two-photon imaging probe, acts by labelling plaques and cerebral amyloid angiopathies (CAAs).
| Catalog Num | A22102 |
|---|---|
| M. Wt | 486.32 |
| Formula | C27H25BF2N4O2 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1623747-97-6 |
| Synonyms | CRANAD 28; CRANAD28 |
| SMILES | CC1=C(/C=C/C2=OB(F)(F)OC(CCC3=C(C)N(C4=CC=CC=C4)N=C3)=C2)C=NN1C5=CC=CC=C5 |
CRANAD-28, a blood brain barrier (BBB) penetrable two-photon imaging probe, acts by labelling plaques and cerebral amyloid angiopathies (CAAs).
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.56 mL | 102.81 mL | 205.63 mL |
| 0.5 mM | 4.11 mL | 20.56 mL | 41.13 mL |
| 1 mM | 2.06 mL | 10.28 mL | 20.56 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.11 mL |
*The above data is based on the productmolecular weight 486.32. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.