Cytosporone B
Catalog No. A22115
Cytosporone B (Csn-B; Dothiorelone G) is a naturally occurring nuclear orphan receptor Nur77/NR4A1 agonist with an EC50 of 0.278 nM.
| Catalog Num | A22115 |
|---|---|
| M. Wt | 322.4 |
| Formula | C18H26O5 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 321661-62-5 |
| Synonyms | Csn-B; Dothiorelone G |
| SMILES | O=C(OCC)CC1=CC(O)=CC(O)=C1C(CCCCCCC)=O |
Cytosporone B (Csn-B; Dothiorelone G) is a naturally occurring nuclear orphan receptor Nur77/NR4A1 agonist with an EC50 of 0.278 nM.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.02 mL | 155.09 mL | 310.17 mL |
| 0.5 mM | 6.2 mL | 31.02 mL | 62.03 mL |
| 1 mM | 3.1 mL | 15.51 mL | 31.02 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.2 mL |
*The above data is based on the productmolecular weight 322.4. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.