5-HT3 antagonist-4i
Catalog No. A22265
5-HT3 antagonist-4i is a 5-HT3 receptor antagonist which modulates the serotonergic system.
Catalog Num | A22265 |
---|---|
M. Wt | 297.74 |
Formula | C16H12ClN3O |
Purity | >98% |
Storage | at -20°C 3 years Powder |
CAS No. | 930478-88-9 |
Synonyms | |
SMILES | O=C(C1=NC2=CC=CC=C2N=C1)NC3=CC=CC(Cl)=C3C |
5-HT3 antagonist-4i is a 5-HT3 receptor antagonist which modulates the serotonergic system.
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 33.59 mL | 167.93 mL | 335.86 mL |
0.5 mM | 6.72 mL | 33.59 mL | 67.17 mL |
1 mM | 3.36 mL | 16.79 mL | 33.59 mL |
5 mM | 0.67 mL | 3.36 mL | 6.72 mL |
*The above data is based on the productmolecular weight 297.74. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.