GMB475
Catalog No. A22279
GMB-475 is a degrader of BCR-ABL1 tyrosine kinase based on PROTAC, overcoming BCR-ABL1-dependent drug resistance.
| Catalog Num | A22279 |
|---|---|
| M. Wt | 861.93 |
| Formula | C43H46F3N7O7S |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 2490599-18-1 |
| Synonyms | |
| SMILES | FC(F)(F)OC1=CC=C(NC2=CC(C3=CC=C(OCCOCC(N[C@H](C(C)(C)C)C(N4[C@H](C(NCC5=CC=C(C6=C(C)N=CS6)C=C5)=O)CC(O)C4)=O)=O)C=C3)=NC=N2)C=C1 |
GMB-475 is a degrader of BCR-ABL1 tyrosine kinase based on PROTAC, overcoming BCR-ABL1-dependent drug resistance.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.6 mL | 58.01 mL | 116.02 mL |
| 0.5 mM | 2.32 mL | 11.6 mL | 23.2 mL |
| 1 mM | 1.16 mL | 5.8 mL | 11.6 mL |
| 5 mM | 0.23 mL | 1.16 mL | 2.32 mL |
*The above data is based on the productmolecular weight 861.93. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.