Alisol B
Catalog No. A22435
Alisol B is a potentially novel therapeutic compound for bone disorders by targeting the differentiation of osteoclasts as well as their functions.
| Catalog Num | A22435 |
|---|---|
| M. Wt | 472.7 |
| Formula | C30H48O4 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 18649-93-9 |
| Synonyms | |
| SMILES | C[C@]([C@@]1(C2=C([C@H](C)C[C@@H]([C@]3([H])C(C)(C)O3)O)CC1)C)(CC[C@@]4([H])C5(C)C)[C@]([C@H](C2)O)([H])[C@]4(CCC5=O)C |
Alisol B is a potentially novel therapeutic compound for bone disorders by targeting the differentiation of osteoclasts as well as their functions.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.16 mL | 105.78 mL | 211.55 mL |
| 0.5 mM | 4.23 mL | 21.16 mL | 42.31 mL |
| 1 mM | 2.12 mL | 10.58 mL | 21.16 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.23 mL |
*The above data is based on the productmolecular weight 472.7. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.